C22H40ClN — CID 173450518
N,N-diethyl-12-phenyldodecan-1-amine;hydrochloride (PubChem CID 173450518) has the molecular formula C22H40ClN and a molecular weight of 354.02 g/mol. Its IUPAC name is N,N-diethyl-12-phenyldodecan-1-amine;hydrochloride.
| Compound Name | N,N-diethyl-12-phenyldodecan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 173450518 |
| Molecular Formula | C22H40ClN |
| Molecular Weight | 354.02 g/mol |
| Exact Mass | 353.28 |
| IUPAC Name | N,N-diethyl-12-phenyldodecan-1-amine;hydrochloride |
| SMILES | CCN(CC)CCCCCCCCCCCCc1ccccc1.Cl |
| InChI | InChI=1S/C22H39N.ClH/c1-3-23(4-2)21-17-12-10-8-6-5-7-9-11-14-18-22-19-15-13-16-20-22;/h13,15-16,19-20H,3-12,14,17-18,21H2,1-2H3;1H |
| InChIKey | FSXMVAHLRJGUMX-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.02 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|