C16H29N3O — CID 102991610
4-amino-2-[[3-(diethylamino)propyl-ethylamino]methyl]phenol (PubChem CID 102991610) has the molecular formula C16H29N3O and a molecular weight of 279.43 g/mol. Its IUPAC name is 4-amino-2-[[3-(diethylamino)propyl-ethylamino]methyl]phenol.
| Compound Name | 4-amino-2-[[3-(diethylamino)propyl-ethylamino]methyl]phenol |
|---|---|
| PubChem CID | 102991610 |
| Molecular Formula | C16H29N3O |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.23 |
| IUPAC Name | 4-amino-2-[[3-(diethylamino)propyl-ethylamino]methyl]phenol |
| SMILES | CCN(CC)CCCN(CC)Cc1cc(N)ccc1O |
| InChI | InChI=1S/C16H29N3O/c1-4-18(5-2)10-7-11-19(6-3)13-14-12-15(17)8-9-16(14)20/h8-9,12,20H,4-7,10-11,13,17H2,1-3H3 |
| InChIKey | VPFLQTHLYVQRKF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 52.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|