C20H26N4O6 — CID 19704517
2-[(5-amino-2-hydroxyphenyl)methyl-[2-[(5-amino-2-hydroxyphenyl)methyl-(carboxymethyl)amino]ethyl]amino]acetic acid (PubChem CID 19704517) has the molecular formula C20H26N4O6 and a molecular weight of 418.45 g/mol. Its IUPAC name is 2-[(5-amino-2-hydroxyphenyl)methyl-[2-[(5-amino-2-hydroxyphenyl)methyl-(carboxymethyl)amino]ethyl]amino]acetic acid.
| Compound Name | 2-[(5-amino-2-hydroxyphenyl)methyl-[2-[(5-amino-2-hydroxyphenyl)methyl-(carboxymethyl)amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 19704517 |
| Molecular Formula | C20H26N4O6 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 2-[(5-amino-2-hydroxyphenyl)methyl-[2-[(5-amino-2-hydroxyphenyl)methyl-(carboxymethyl)amino]ethyl]amino]acetic acid |
| SMILES | Nc1ccc(O)c(CN(CCN(CC(=O)O)Cc2cc(N)ccc2O)CC(=O)O)c1 |
| InChI | InChI=1S/C20H26N4O6/c21-15-1-3-17(25)13(7-15)9-23(11-19(27)28)5-6-24(12-20(29)30)10-14-8-16(22)2-4-18(14)26/h1-4,7-8,25-26H,5-6,9-12,21-22H2,(H,27,28)(H,29,30) |
| InChIKey | AGTXFUZRLSPRAT-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 173.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|