C21H32N2O6 — CID 176943858
3-[3-[[carboxymethyl-[2-[ethyl-[(E)-3-hydroxypent-3-enyl]amino]ethyl]amino]methyl]-4-hydroxyphenyl]propanoic acid (PubChem CID 176943858) has the molecular formula C21H32N2O6 and a molecular weight of 408.50 g/mol. Its IUPAC name is 3-[3-[[carboxymethyl-[2-[ethyl-[(E)-3-hydroxypent-3-enyl]amino]ethyl]amino]methyl]-4-hydroxyphenyl]propanoic acid.
| Compound Name | 3-[3-[[carboxymethyl-[2-[ethyl-[(E)-3-hydroxypent-3-enyl]amino]ethyl]amino]methyl]-4-hydroxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 176943858 |
| Molecular Formula | C21H32N2O6 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 3-[3-[[carboxymethyl-[2-[ethyl-[(E)-3-hydroxypent-3-enyl]amino]ethyl]amino]methyl]-4-hydroxyphenyl]propanoic acid |
| SMILES | C/C=C(/O)CCN(CC)CCN(CC(=O)O)Cc1cc(CCC(=O)O)ccc1O |
| InChI | InChI=1S/C21H32N2O6/c1-3-18(24)9-10-22(4-2)11-12-23(15-21(28)29)14-17-13-16(5-7-19(17)25)6-8-20(26)27/h3,5,7,13,24-25H,4,6,8-12,14-15H2,1-2H3,(H,26,27)(H,28,29)/b18-3+ |
| InChIKey | KSSZXODWKFERDG-JFQJCAQQSA-N |
| XLogP | 2.47 |
| TPSA | 121.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|