C26H32N2O10 — CID 164754092
3-[3-[[carboxymethyl-[2-[[5-(2-formyloxyethyl)-2-hydroxyphenyl]methyl-(formyloxymethyl)amino]ethyl]amino]methyl]-4-hydroxyphenyl]propanoic acid (PubChem CID 164754092) has the molecular formula C26H32N2O10 and a molecular weight of 532.55 g/mol. Its IUPAC name is 3-[3-[[carboxymethyl-[2-[[5-(2-formyloxyethyl)-2-hydroxyphenyl]methyl-(formyloxymethyl)amino]ethyl]amino]methyl]-4-hydroxyphenyl]propanoic acid.
| Compound Name | 3-[3-[[carboxymethyl-[2-[[5-(2-formyloxyethyl)-2-hydroxyphenyl]methyl-(formyloxymethyl)amino]ethyl]amino]methyl]-4-hydroxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 164754092 |
| Molecular Formula | C26H32N2O10 |
| Molecular Weight | 532.55 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | 3-[3-[[carboxymethyl-[2-[[5-(2-formyloxyethyl)-2-hydroxyphenyl]methyl-(formyloxymethyl)amino]ethyl]amino]methyl]-4-hydroxyphenyl]propanoic acid |
| SMILES | O=COCCc1ccc(O)c(CN(CCN(CC(=O)O)Cc2cc(CCC(=O)O)ccc2O)COC=O)c1 |
| InChI | InChI=1S/C26H32N2O10/c29-17-37-10-7-20-2-5-24(32)22(12-20)14-28(16-38-18-30)9-8-27(15-26(35)36)13-21-11-19(1-4-23(21)31)3-6-25(33)34/h1-2,4-5,11-12,17-18,31-32H,3,6-10,13-16H2,(H,33,34)(H,35,36) |
| InChIKey | DXVPVURDXVEPPN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 174.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.55 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|