C20H24N2O8 — CID 70833151
2-[2-[carboxymethyl-[(2,5-dihydroxyphenyl)methyl]amino]ethyl-[(2,5-dihydroxyphenyl)methyl]amino]acetic acid (PubChem CID 70833151) has the molecular formula C20H24N2O8 and a molecular weight of 420.42 g/mol. Its IUPAC name is 2-[2-[carboxymethyl-[(2,5-dihydroxyphenyl)methyl]amino]ethyl-[(2,5-dihydroxyphenyl)methyl]amino]acetic acid.
| Compound Name | 2-[2-[carboxymethyl-[(2,5-dihydroxyphenyl)methyl]amino]ethyl-[(2,5-dihydroxyphenyl)methyl]amino]acetic acid |
|---|---|
| PubChem CID | 70833151 |
| Molecular Formula | C20H24N2O8 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 2-[2-[carboxymethyl-[(2,5-dihydroxyphenyl)methyl]amino]ethyl-[(2,5-dihydroxyphenyl)methyl]amino]acetic acid |
| SMILES | O=C(O)CN(CCN(CC(=O)O)Cc1cc(O)ccc1O)Cc1cc(O)ccc1O |
| InChI | InChI=1S/C20H24N2O8/c23-15-1-3-17(25)13(7-15)9-21(11-19(27)28)5-6-22(12-20(29)30)10-14-8-16(24)2-4-18(14)26/h1-4,7-8,23-26H,5-6,9-12H2,(H,27,28)(H,29,30) |
| InChIKey | VWZCQIKSLKKELH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 162.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|