C14H23NO3 — CID 143297928
N-[2-(2,5-dihydroxyphenyl)ethyl]-N-propylformamide;ethane (PubChem CID 143297928) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is N-[2-(2,5-dihydroxyphenyl)ethyl]-N-propylformamide;ethane.
| Compound Name | N-[2-(2,5-dihydroxyphenyl)ethyl]-N-propylformamide;ethane |
|---|---|
| PubChem CID | 143297928 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | N-[2-(2,5-dihydroxyphenyl)ethyl]-N-propylformamide;ethane |
| SMILES | CC.CCCN(C=O)CCc1cc(O)ccc1O |
| InChI | InChI=1S/C12H17NO3.C2H6/c1-2-6-13(9-14)7-5-10-8-11(15)3-4-12(10)16;1-2/h3-4,8-9,15-16H,2,5-7H2,1H3;1-2H3 |
| InChIKey | VOXFTNBTNGMNCS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|