C9H12O3 — CID 19362191
2-(3-hydroxypropyl)benzene-1,4-diol (PubChem CID 19362191) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is 2-(3-hydroxypropyl)benzene-1,4-diol.
| Compound Name | 2-(3-hydroxypropyl)benzene-1,4-diol |
|---|---|
| PubChem CID | 19362191 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 2-(3-hydroxypropyl)benzene-1,4-diol |
| SMILES | OCCCc1cc(O)ccc1O |
| InChI | InChI=1S/C9H12O3/c10-5-1-2-7-6-8(11)3-4-9(7)12/h3-4,6,10-12H,1-2,5H2 |
| InChIKey | RYBASNPKFUXSHE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|