C16H24FeN2NaO6+ — CID 170846192
sodium;2-[2-[carboxymethyl-[(2-hydroxy-5-methylphenyl)methyl]amino]ethyl-(2-hydroxyethyl)amino]acetic acid;iron (PubChem CID 170846192) has the molecular formula C16H24FeN2NaO6+ and a molecular weight of 419.21 g/mol. Its IUPAC name is sodium;2-[2-[carboxymethyl-[(2-hydroxy-5-methylphenyl)methyl]amino]ethyl-(2-hydroxyethyl)amino]acetic acid;iron.
| Compound Name | sodium;2-[2-[carboxymethyl-[(2-hydroxy-5-methylphenyl)methyl]amino]ethyl-(2-hydroxyethyl)amino]acetic acid;iron |
|---|---|
| PubChem CID | 170846192 |
| Molecular Formula | C16H24FeN2NaO6+ |
| Molecular Weight | 419.21 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | sodium;2-[2-[carboxymethyl-[(2-hydroxy-5-methylphenyl)methyl]amino]ethyl-(2-hydroxyethyl)amino]acetic acid;iron |
| SMILES | Cc1ccc(O)c(CN(CCN(CCO)CC(=O)O)CC(=O)O)c1.[Fe].[Na+] |
| InChI | InChI=1S/C16H24N2O6.Fe.Na/c1-12-2-3-14(20)13(8-12)9-18(11-16(23)24)5-4-17(6-7-19)10-15(21)22;;/h2-3,8,19-20H,4-7,9-11H2,1H3,(H,21,22)(H,23,24);;/q;;+1 |
| InChIKey | LSRILNAAPCLUPN-UHFFFAOYSA-N |
| XLogP | -3.03 |
| TPSA | 121.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.21 |
| LogP ≤ 5 | -3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|