C10H22FeN3O7+ — CID 163360235
azanium;2-[2-[bis(carboxymethyl)amino]ethyl-(2-hydroxyethyl)amino]acetic acid;iron (PubChem CID 163360235) has the molecular formula C10H22FeN3O7+ and a molecular weight of 352.15 g/mol. Its IUPAC name is azanium;2-[2-[bis(carboxymethyl)amino]ethyl-(2-hydroxyethyl)amino]acetic acid;iron.
| Compound Name | azanium;2-[2-[bis(carboxymethyl)amino]ethyl-(2-hydroxyethyl)amino]acetic acid;iron |
|---|---|
| PubChem CID | 163360235 |
| Molecular Formula | C10H22FeN3O7+ |
| Molecular Weight | 352.15 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | azanium;2-[2-[bis(carboxymethyl)amino]ethyl-(2-hydroxyethyl)amino]acetic acid;iron |
| SMILES | O=C(O)CN(CCO)CCN(CC(=O)O)CC(=O)O.[Fe].[NH4+] |
| InChI | InChI=1S/C10H18N2O7.Fe.H3N/c13-4-3-11(5-8(14)15)1-2-12(6-9(16)17)7-10(18)19;;/h13H,1-7H2,(H,14,15)(H,16,17)(H,18,19);;1H3/p+1 |
| InChIKey | OHSBYLRKEWMOKA-UHFFFAOYSA-O |
| XLogP | -1.79 |
| TPSA | 175.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.15 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|