C6H11NNaO5 — CID 87469111
CID 87469111 (PubChem CID 87469111) has the molecular formula C6H11NNaO5 and a molecular weight of 200.15 g/mol.
| Compound Name | CID 87469111 |
|---|---|
| PubChem CID | 87469111 |
| Molecular Formula | C6H11NNaO5 |
| Molecular Weight | 200.15 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | — |
| SMILES | O=C(O)CN(CCO)CC(=O)O.[Na] |
| InChI | InChI=1S/C6H11NO5.Na/c8-2-1-7(3-5(9)10)4-6(11)12;/h8H,1-4H2,(H,9,10)(H,11,12); |
| InChIKey | IDOZIFCTUFCBMQ-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.15 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |