C10H18N2NaO8 — CID 176507832
CID 176507832 (PubChem CID 176507832) has the molecular formula C10H18N2NaO8 and a molecular weight of 317.25 g/mol.
| Compound Name | CID 176507832 |
|---|---|
| PubChem CID | 176507832 |
| Molecular Formula | C10H18N2NaO8 |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | — |
| SMILES | O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O.[H][H].[Na] |
| InChI | InChI=1S/C10H16N2O8.Na.H2/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;1H |
| InChIKey | XOGHONRSXAQANG-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |