C9H10O3 — CID 13360645
2-(2-hydroxy-5-methylphenyl)acetic acid (PubChem CID 13360645) has the molecular formula C9H10O3 and a molecular weight of 166.18 g/mol. Its IUPAC name is 2-(2-hydroxy-5-methylphenyl)acetic acid.
| Compound Name | 2-(2-hydroxy-5-methylphenyl)acetic acid |
|---|---|
| PubChem CID | 13360645 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 2-(2-hydroxy-5-methylphenyl)acetic acid |
| SMILES | Cc1ccc(O)c(CC(=O)O)c1 |
| InChI | InChI=1S/C9H10O3/c1-6-2-3-8(10)7(4-6)5-9(11)12/h2-4,10H,5H2,1H3,(H,11,12) |
| InChIKey | RDMFKTGZYKNWGQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |