About 2-[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol;tetrachlorotungsten
2-[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol;tetrachlorotungsten (PubChem CID 153466850) has the molecular formula C15H16Cl4O2W
and a molecular weight of 553.94 g/mol. Its IUPAC name is 2-[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol;tetrachlorotungsten.
Molecular Properties
| Compound Name | 2-[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol;tetrachlorotungsten |
| PubChem CID | 153466850 |
| Molecular Formula | C15H16Cl4O2W |
| Molecular Weight | 553.94 g/mol |
| Exact Mass | 551.94 |
| IUPAC Name | 2-[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol;tetrachlorotungsten |
| SMILES | Cc1ccc(O)c(Cc2cc(C)ccc2O)c1.Cl[W](Cl)(Cl)Cl |
| InChI | InChI=1S/C15H16O2.4ClH.W/c1-10-3-5-14(16)12(7-10)9-13-8-11(2)4-6-15(13)17;;;;;/h3-8,16-17H,9H2,1-2H3;4*1H;/q;;;;;+4/p-4 |
| InChIKey | POTCJFUHBIBQBJ-UHFFFAOYSA-J |
| XLogP | 6.06 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 553.94 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol;tetrachlorotungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol;tetrachlorotungsten?
The IUPAC name of 2-[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol;tetrachlorotungsten (CID 153466850) is 2-[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol;tetrachlorotungsten.
What is the SMILES notation for 2-[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol;tetrachlorotungsten?
The canonical SMILES for 2-[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol;tetrachlorotungsten is Cc1ccc(O)c(Cc2cc(C)ccc2O)c1.Cl[W](Cl)(Cl)Cl.
What is the InChIKey of 2-[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol;tetrachlorotungsten?
The InChIKey is POTCJFUHBIBQBJ-UHFFFAOYSA-J. The full InChI is InChI=1S/C15H16O2.4ClH.W/c1-10-3-5-14(16)12(7-10)9-13-8-11(2)4-6-15(13)17;;;;;/h3-8,16-17H,9H2,1-2H3;4*1H;/q;;;;;+4/p-4.
What are the key properties of 2-[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol;tetrachlorotungsten?
2-[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol;tetrachlorotungsten has a molecular weight of 553.94 g/mol, XLogP of 6.06, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol;tetrachlorotungsten is sourced from PubChem (CID 153466850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).