C23H27O3P — CID 174155977
2,6-bis[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol;phosphane (PubChem CID 174155977) has the molecular formula C23H27O3P and a molecular weight of 382.44 g/mol. Its IUPAC name is 2,6-bis[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol;phosphane.
| Compound Name | 2,6-bis[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol;phosphane |
|---|---|
| PubChem CID | 174155977 |
| Molecular Formula | C23H27O3P |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 2,6-bis[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol;phosphane |
| SMILES | Cc1ccc(O)c(Cc2cc(C)cc(Cc3cc(C)ccc3O)c2O)c1.P |
| InChI | InChI=1S/C23H24O3.H3P/c1-14-4-6-21(24)17(8-14)12-19-10-16(3)11-20(23(19)26)13-18-9-15(2)5-7-22(18)25;/h4-11,24-26H,12-13H2,1-3H3;1H3 |
| InChIKey | TUXYYAGINSZCJJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|