C17H20O — CID 21015145
4-methyl-2-[(2,3,5-trimethylphenyl)methyl]phenol (PubChem CID 21015145) has the molecular formula C17H20O and a molecular weight of 240.35 g/mol. Its IUPAC name is 4-methyl-2-[(2,3,5-trimethylphenyl)methyl]phenol.
| Compound Name | 4-methyl-2-[(2,3,5-trimethylphenyl)methyl]phenol |
|---|---|
| PubChem CID | 21015145 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 4-methyl-2-[(2,3,5-trimethylphenyl)methyl]phenol |
| SMILES | Cc1ccc(O)c(Cc2cc(C)cc(C)c2C)c1 |
| InChI | InChI=1S/C17H20O/c1-11-5-6-17(18)16(8-11)10-15-9-12(2)7-13(3)14(15)4/h5-9,18H,10H2,1-4H3 |
| InChIKey | KFHRQRBUGPSCDS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |