C11H13NO6 — CID 11449211
2-[carboxymethyl-[(2,3-dihydroxyphenyl)methyl]amino]acetic acid (PubChem CID 11449211) has the molecular formula C11H13NO6 and a molecular weight of 255.23 g/mol. Its IUPAC name is 2-[carboxymethyl-[(2,3-dihydroxyphenyl)methyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[(2,3-dihydroxyphenyl)methyl]amino]acetic acid |
|---|---|
| PubChem CID | 11449211 |
| Molecular Formula | C11H13NO6 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 2-[carboxymethyl-[(2,3-dihydroxyphenyl)methyl]amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)Cc1cccc(O)c1O |
| InChI | InChI=1S/C11H13NO6/c13-8-3-1-2-7(11(8)18)4-12(5-9(14)15)6-10(16)17/h1-3,13,18H,4-6H2,(H,14,15)(H,16,17) |
| InChIKey | TXFLZOHBLQFEPD-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|