C16H20N2O9 — CID 5242005
2-[[3-[[bis(carboxymethyl)amino]methyl]-2-hydroxyphenyl]methyl-(carboxymethyl)amino]acetic acid (PubChem CID 5242005) has the molecular formula C16H20N2O9 and a molecular weight of 384.34 g/mol. Its IUPAC name is 2-[[3-[[bis(carboxymethyl)amino]methyl]-2-hydroxyphenyl]methyl-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[[3-[[bis(carboxymethyl)amino]methyl]-2-hydroxyphenyl]methyl-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 5242005 |
| Molecular Formula | C16H20N2O9 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 2-[[3-[[bis(carboxymethyl)amino]methyl]-2-hydroxyphenyl]methyl-(carboxymethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)Cc1cccc(CN(CC(=O)O)CC(=O)O)c1O |
| InChI | InChI=1S/C16H20N2O9/c19-12(20)6-17(7-13(21)22)4-10-2-1-3-11(16(10)27)5-18(8-14(23)24)9-15(25)26/h1-3,27H,4-9H2,(H,19,20)(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | ZSEIKHVDRKRGOT-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 175.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|