C11H13ClFNO2 — CID 114489081
2-[(3-chloro-2-fluorophenyl)methyl-ethylamino]acetic acid (PubChem CID 114489081) has the molecular formula C11H13ClFNO2 and a molecular weight of 245.68 g/mol. Its IUPAC name is 2-[(3-chloro-2-fluorophenyl)methyl-ethylamino]acetic acid.
| Compound Name | 2-[(3-chloro-2-fluorophenyl)methyl-ethylamino]acetic acid |
|---|---|
| PubChem CID | 114489081 |
| Molecular Formula | C11H13ClFNO2 |
| Molecular Weight | 245.68 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 2-[(3-chloro-2-fluorophenyl)methyl-ethylamino]acetic acid |
| SMILES | CCN(CC(=O)O)Cc1cccc(Cl)c1F |
| InChI | InChI=1S/C11H13ClFNO2/c1-2-14(7-10(15)16)6-8-4-3-5-9(12)11(8)13/h3-5H,2,6-7H2,1H3,(H,15,16) |
| InChIKey | KAKKNGSTXMRRJK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.68 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |