C12H13NO8 — CID 68616955
3-[[bis(carboxymethyl)amino]methyl]-4,5-dihydroxybenzoic acid (PubChem CID 68616955) has the molecular formula C12H13NO8 and a molecular weight of 299.24 g/mol. Its IUPAC name is 3-[[bis(carboxymethyl)amino]methyl]-4,5-dihydroxybenzoic acid.
| Compound Name | 3-[[bis(carboxymethyl)amino]methyl]-4,5-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 68616955 |
| Molecular Formula | C12H13NO8 |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 3-[[bis(carboxymethyl)amino]methyl]-4,5-dihydroxybenzoic acid |
| SMILES | O=C(O)CN(CC(=O)O)Cc1cc(C(=O)O)cc(O)c1O |
| InChI | InChI=1S/C12H13NO8/c14-8-2-6(12(20)21)1-7(11(8)19)3-13(4-9(15)16)5-10(17)18/h1-2,14,19H,3-5H2,(H,15,16)(H,17,18)(H,20,21) |
| InChIKey | PCFFYQSPGPEFIC-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 155.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|