C17H17NO9S — CID 171527942
3-[[carboxymethyl-[(2-hydroxy-5-sulfophenyl)methyl]amino]methyl]-4-hydroxybenzoic acid (PubChem CID 171527942) has the molecular formula C17H17NO9S and a molecular weight of 411.39 g/mol. Its IUPAC name is 3-[[carboxymethyl-[(2-hydroxy-5-sulfophenyl)methyl]amino]methyl]-4-hydroxybenzoic acid.
| Compound Name | 3-[[carboxymethyl-[(2-hydroxy-5-sulfophenyl)methyl]amino]methyl]-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 171527942 |
| Molecular Formula | C17H17NO9S |
| Molecular Weight | 411.39 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 3-[[carboxymethyl-[(2-hydroxy-5-sulfophenyl)methyl]amino]methyl]-4-hydroxybenzoic acid |
| SMILES | O=C(O)CN(Cc1cc(C(=O)O)ccc1O)Cc1cc(S(=O)(=O)O)ccc1O |
| InChI | InChI=1S/C17H17NO9S/c19-14-3-1-10(17(23)24)5-11(14)7-18(9-16(21)22)8-12-6-13(28(25,26)27)2-4-15(12)20/h1-6,19-20H,7-9H2,(H,21,22)(H,23,24)(H,25,26,27) |
| InChIKey | XXZVOAFZQHYBNR-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 172.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.39 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|