C12H15NO12S2 — CID 174826540
benzene-1,4-disulfonic acid;2-[bis(carboxymethyl)amino]acetic acid (PubChem CID 174826540) has the molecular formula C12H15NO12S2 and a molecular weight of 429.38 g/mol. Its IUPAC name is benzene-1,4-disulfonic acid;2-[bis(carboxymethyl)amino]acetic acid.
| Compound Name | benzene-1,4-disulfonic acid;2-[bis(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 174826540 |
| Molecular Formula | C12H15NO12S2 |
| Molecular Weight | 429.38 g/mol |
| Exact Mass | 429.00 |
| IUPAC Name | benzene-1,4-disulfonic acid;2-[bis(carboxymethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)CC(=O)O.O=S(=O)(O)c1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C6H9NO6.C6H6O6S2/c8-4(9)1-7(2-5(10)11)3-6(12)13;7-13(8,9)5-1-2-6(4-3-5)14(10,11)12/h1-3H2,(H,8,9)(H,10,11)(H,12,13);1-4H,(H,7,8,9)(H,10,11,12) |
| InChIKey | YDASDHVMHXEVTR-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 223.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.38 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|