C6H9CaNO6 — CID 23617736
CID 23617736 (PubChem CID 23617736) has the molecular formula C6H9CaNO6 and a molecular weight of 231.22 g/mol.
| Compound Name | CID 23617736 |
|---|---|
| PubChem CID | 23617736 |
| Molecular Formula | C6H9CaNO6 |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.01 |
| IUPAC Name | — |
| SMILES | O=C(O)CN(CC(=O)O)CC(=O)O.[Ca] |
| InChI | InChI=1S/C6H9NO6.Ca/c8-4(9)1-7(2-5(10)11)3-6(12)13;/h1-3H2,(H,8,9)(H,10,11)(H,12,13); |
| InChIKey | CMKVOJSFDPEZLV-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |