C9H26N6O8 — CID 173034412
azane;2-[[bis(carboxymethyl)amino]methyl-(carboxymethyl)amino]acetic acid (PubChem CID 173034412) has the molecular formula C9H26N6O8 and a molecular weight of 346.34 g/mol. Its IUPAC name is azane;2-[[bis(carboxymethyl)amino]methyl-(carboxymethyl)amino]acetic acid.
| Compound Name | azane;2-[[bis(carboxymethyl)amino]methyl-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 173034412 |
| Molecular Formula | C9H26N6O8 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | azane;2-[[bis(carboxymethyl)amino]methyl-(carboxymethyl)amino]acetic acid |
| SMILES | N.N.N.N.O=C(O)CN(CC(=O)O)CN(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C9H14N2O8.4H3N/c12-6(13)1-10(2-7(14)15)5-11(3-8(16)17)4-9(18)19;;;;/h1-5H2,(H,12,13)(H,14,15)(H,16,17)(H,18,19);4*1H3 |
| InChIKey | FYANJEFKPDBAPM-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 295.68 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|