C16H27N3O9 — CID 89143910
2-[[[bis(carboxymethyl)amino]methyl-(3,3-dimethyl-2-oxobutyl)amino]methyl-(carboxymethyl)amino]acetic acid (PubChem CID 89143910) has the molecular formula C16H27N3O9 and a molecular weight of 405.40 g/mol. Its IUPAC name is 2-[[[bis(carboxymethyl)amino]methyl-(3,3-dimethyl-2-oxobutyl)amino]methyl-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[[[bis(carboxymethyl)amino]methyl-(3,3-dimethyl-2-oxobutyl)amino]methyl-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 89143910 |
| Molecular Formula | C16H27N3O9 |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 2-[[[bis(carboxymethyl)amino]methyl-(3,3-dimethyl-2-oxobutyl)amino]methyl-(carboxymethyl)amino]acetic acid |
| SMILES | CC(C)(C)C(=O)CN(CN(CC(=O)O)CC(=O)O)CN(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C16H27N3O9/c1-16(2,3)11(20)4-19(9-17(5-12(21)22)6-13(23)24)10-18(7-14(25)26)8-15(27)28/h4-10H2,1-3H3,(H,21,22)(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | CYWOBZSAURBIBP-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 175.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|