About azanium;2-[bis(carboxymethyl)amino]acetic acid;manganese
azanium;2-[bis(carboxymethyl)amino]acetic acid;manganese (PubChem CID 71301305) has the molecular formula C6H13MnN2O6+
and a molecular weight of 264.12 g/mol. Its IUPAC name is azanium;2-[bis(carboxymethyl)amino]acetic acid;manganese.
Molecular Properties
| Compound Name | azanium;2-[bis(carboxymethyl)amino]acetic acid;manganese |
| PubChem CID | 71301305 |
| Molecular Formula | C6H13MnN2O6+ |
| Molecular Weight | 264.12 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | azanium;2-[bis(carboxymethyl)amino]acetic acid;manganese |
| SMILES | O=C(O)CN(CC(=O)O)CC(=O)O.[Mn].[NH4+] |
| InChI | InChI=1S/C6H9NO6.Mn.H3N/c8-4(9)1-7(2-5(10)11)3-6(12)13;;/h1-3H2,(H,8,9)(H,10,11)(H,12,13);;1H3/p+1 |
| InChIKey | UVWURPKOEPNXPN-UHFFFAOYSA-O |
| XLogP | -1.08 |
| TPSA | 151.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.12 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azanium;2-[bis(carboxymethyl)amino]acetic acid;manganese with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;2-[bis(carboxymethyl)amino]acetic acid;manganese?
The IUPAC name of azanium;2-[bis(carboxymethyl)amino]acetic acid;manganese (CID 71301305) is azanium;2-[bis(carboxymethyl)amino]acetic acid;manganese.
What is the SMILES notation for azanium;2-[bis(carboxymethyl)amino]acetic acid;manganese?
The canonical SMILES for azanium;2-[bis(carboxymethyl)amino]acetic acid;manganese is O=C(O)CN(CC(=O)O)CC(=O)O.[Mn].[NH4+].
What is the InChIKey of azanium;2-[bis(carboxymethyl)amino]acetic acid;manganese?
The InChIKey is UVWURPKOEPNXPN-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H9NO6.Mn.H3N/c8-4(9)1-7(2-5(10)11)3-6(12)13;;/h1-3H2,(H,8,9)(H,10,11)(H,12,13);;1H3/p+1.
What are the key properties of azanium;2-[bis(carboxymethyl)amino]acetic acid;manganese?
azanium;2-[bis(carboxymethyl)amino]acetic acid;manganese has a molecular weight of 264.12 g/mol, XLogP of -1.08, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;2-[bis(carboxymethyl)amino]acetic acid;manganese is sourced from PubChem (CID 71301305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).