About benzenesulfonic acid
benzenesulfonic acid (PubChem CID 87196622) has the molecular formula C12H12O6S2
and a molecular weight of 316.36 g/mol. Its IUPAC name is benzenesulfonic acid.
Molecular Properties
| Compound Name | benzenesulfonic acid |
| PubChem CID | 87196622 |
| Molecular Formula | C12H12O6S2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccccc1.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/2C6H6O3S/c2*7-10(8,9)6-4-2-1-3-5-6/h2*1-5H,(H,7,8,9) |
| InChIKey | WWIWLTSSHDKOKO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze benzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfonic acid?
The IUPAC name of benzenesulfonic acid (CID 87196622) is benzenesulfonic acid.
What is the SMILES notation for benzenesulfonic acid?
The canonical SMILES for benzenesulfonic acid is O=S(=O)(O)c1ccccc1.O=S(=O)(O)c1ccccc1.
What is the InChIKey of benzenesulfonic acid?
The InChIKey is WWIWLTSSHDKOKO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H6O3S/c2*7-10(8,9)6-4-2-1-3-5-6/h2*1-5H,(H,7,8,9).
What are the key properties of benzenesulfonic acid?
benzenesulfonic acid has a molecular weight of 316.36 g/mol, XLogP of 1.87, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfonic acid is sourced from PubChem (CID 87196622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).