About benzenesulfonic acid;mercury(1+);hydrate
benzenesulfonic acid;mercury(1+);hydrate (PubChem CID 21150893) has the molecular formula C6H8HgO4S+
and a molecular weight of 376.78 g/mol. Its IUPAC name is benzenesulfonic acid;mercury(1+);hydrate.
Molecular Properties
| Compound Name | benzenesulfonic acid;mercury(1+);hydrate |
| PubChem CID | 21150893 |
| Molecular Formula | C6H8HgO4S+ |
| Molecular Weight | 376.78 g/mol |
| Exact Mass | 377.98 |
| IUPAC Name | benzenesulfonic acid;mercury(1+);hydrate |
| SMILES | O.O=S(=O)(O)c1ccccc1.[Hg+] |
| InChI | InChI=1S/C6H6O3S.Hg.H2O/c7-10(8,9)6-4-2-1-3-5-6;;/h1-5H,(H,7,8,9);;1H2/q;+1; |
| InChIKey | COTVVODXYBINMH-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 85.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.78 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze benzenesulfonic acid;mercury(1+);hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfonic acid;mercury(1+);hydrate?
The IUPAC name of benzenesulfonic acid;mercury(1+);hydrate (CID 21150893) is benzenesulfonic acid;mercury(1+);hydrate.
What is the SMILES notation for benzenesulfonic acid;mercury(1+);hydrate?
The canonical SMILES for benzenesulfonic acid;mercury(1+);hydrate is O.O=S(=O)(O)c1ccccc1.[Hg+].
What is the InChIKey of benzenesulfonic acid;mercury(1+);hydrate?
The InChIKey is COTVVODXYBINMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O3S.Hg.H2O/c7-10(8,9)6-4-2-1-3-5-6;;/h1-5H,(H,7,8,9);;1H2/q;+1;.
What are the key properties of benzenesulfonic acid;mercury(1+);hydrate?
benzenesulfonic acid;mercury(1+);hydrate has a molecular weight of 376.78 g/mol, XLogP of 0.11, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfonic acid;mercury(1+);hydrate is sourced from PubChem (CID 21150893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).