C10H10O3Zn — CID 67875987
4-hydroxy-3-prop-2-enylbenzoic acid;zinc (PubChem CID 67875987) has the molecular formula C10H10O3Zn and a molecular weight of 243.58 g/mol. Its IUPAC name is 4-hydroxy-3-prop-2-enylbenzoic acid;zinc.
| Compound Name | 4-hydroxy-3-prop-2-enylbenzoic acid;zinc |
|---|---|
| PubChem CID | 67875987 |
| Molecular Formula | C10H10O3Zn |
| Molecular Weight | 243.58 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | 4-hydroxy-3-prop-2-enylbenzoic acid;zinc |
| SMILES | C=CCc1cc(C(=O)O)ccc1O.[Zn] |
| InChI | InChI=1S/C10H10O3.Zn/c1-2-3-7-6-8(10(12)13)4-5-9(7)11;/h2,4-6,11H,1,3H2,(H,12,13); |
| InChIKey | CYKCNMPEVPUKPY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.58 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|