C23H24O4 — CID 139984782
4-[2-(4-carboxy-2-prop-2-enylphenyl)propan-2-yl]-3-prop-2-enylbenzoic acid (PubChem CID 139984782) has the molecular formula C23H24O4 and a molecular weight of 364.44 g/mol. Its IUPAC name is 4-[2-(4-carboxy-2-prop-2-enylphenyl)propan-2-yl]-3-prop-2-enylbenzoic acid.
| Compound Name | 4-[2-(4-carboxy-2-prop-2-enylphenyl)propan-2-yl]-3-prop-2-enylbenzoic acid |
|---|---|
| PubChem CID | 139984782 |
| Molecular Formula | C23H24O4 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 4-[2-(4-carboxy-2-prop-2-enylphenyl)propan-2-yl]-3-prop-2-enylbenzoic acid |
| SMILES | C=CCc1cc(C(=O)O)ccc1C(C)(C)c1ccc(C(=O)O)cc1CC=C |
| InChI | InChI=1S/C23H24O4/c1-5-7-15-13-17(21(24)25)9-11-19(15)23(3,4)20-12-10-18(22(26)27)14-16(20)8-6-2/h5-6,9-14H,1-2,7-8H2,3-4H3,(H,24,25)(H,26,27) |
| InChIKey | CGBHWUOFFOKIKO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|