C29H32O4 — CID 22140263
4-[2-(4-carboxy-2-hex-3-ynylphenyl)propan-2-yl]-3-hex-3-ynylbenzoic acid (PubChem CID 22140263) has the molecular formula C29H32O4 and a molecular weight of 444.57 g/mol. Its IUPAC name is 4-[2-(4-carboxy-2-hex-3-ynylphenyl)propan-2-yl]-3-hex-3-ynylbenzoic acid.
| Compound Name | 4-[2-(4-carboxy-2-hex-3-ynylphenyl)propan-2-yl]-3-hex-3-ynylbenzoic acid |
|---|---|
| PubChem CID | 22140263 |
| Molecular Formula | C29H32O4 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 4-[2-(4-carboxy-2-hex-3-ynylphenyl)propan-2-yl]-3-hex-3-ynylbenzoic acid |
| SMILES | CCC#CCCc1cc(C(=O)O)ccc1C(C)(C)c1ccc(C(=O)O)cc1CCC#CCC |
| InChI | InChI=1S/C29H32O4/c1-5-7-9-11-13-21-19-23(27(30)31)15-17-25(21)29(3,4)26-18-16-24(28(32)33)20-22(26)14-12-10-8-6-2/h15-20H,5-6,11-14H2,1-4H3,(H,30,31)(H,32,33) |
| InChIKey | UFZPVSGVBDRGIH-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|