C20H20O2 — CID 139984859
4,6,8-tris(prop-2-enyl)naphthalene-2-carboxylic acid (PubChem CID 139984859) has the molecular formula C20H20O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 4,6,8-tris(prop-2-enyl)naphthalene-2-carboxylic acid.
| Compound Name | 4,6,8-tris(prop-2-enyl)naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 139984859 |
| Molecular Formula | C20H20O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 4,6,8-tris(prop-2-enyl)naphthalene-2-carboxylic acid |
| SMILES | C=CCc1cc(CC=C)c2cc(C(=O)O)cc(CC=C)c2c1 |
| InChI | InChI=1S/C20H20O2/c1-4-7-14-10-15(8-5-2)19-13-17(20(21)22)12-16(9-6-3)18(19)11-14/h4-6,10-13H,1-3,7-9H2,(H,21,22) |
| InChIKey | WDNQGCIMBCQFEQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|