C23H18F6O4 — CID 139984810
3-[2-(3-carboxy-5-prop-2-enylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-5-prop-2-enylbenzoic acid (PubChem CID 139984810) has the molecular formula C23H18F6O4 and a molecular weight of 472.38 g/mol. Its IUPAC name is 3-[2-(3-carboxy-5-prop-2-enylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-5-prop-2-enylbenzoic acid.
| Compound Name | 3-[2-(3-carboxy-5-prop-2-enylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-5-prop-2-enylbenzoic acid |
|---|---|
| PubChem CID | 139984810 |
| Molecular Formula | C23H18F6O4 |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 3-[2-(3-carboxy-5-prop-2-enylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-5-prop-2-enylbenzoic acid |
| SMILES | C=CCc1cc(C(=O)O)cc(C(c2cc(CC=C)cc(C(=O)O)c2)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C23H18F6O4/c1-3-5-13-7-15(19(30)31)11-17(9-13)21(22(24,25)26,23(27,28)29)18-10-14(6-4-2)8-16(12-18)20(32)33/h3-4,7-12H,1-2,5-6H2,(H,30,31)(H,32,33) |
| InChIKey | CEWMWUATBTZRTJ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|