C11H10O4 — CID 22022689
5-prop-2-enylbenzene-1,3-dicarboxylic acid (PubChem CID 22022689) has the molecular formula C11H10O4 and a molecular weight of 206.20 g/mol. Its IUPAC name is 5-prop-2-enylbenzene-1,3-dicarboxylic acid.
| Compound Name | 5-prop-2-enylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 22022689 |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 5-prop-2-enylbenzene-1,3-dicarboxylic acid |
| SMILES | C=CCc1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C11H10O4/c1-2-3-7-4-8(10(12)13)6-9(5-7)11(14)15/h2,4-6H,1,3H2,(H,12,13)(H,14,15) |
| InChIKey | AKKGEAWNCWLGMB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|