C24H28O2 — CID 139713899
4-[4-(4-hydroxy-3-prop-2-enylphenyl)-4-methylpent-1-en-2-yl]-2-prop-2-enylphenol (PubChem CID 139713899) has the molecular formula C24H28O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is 4-[4-(4-hydroxy-3-prop-2-enylphenyl)-4-methylpent-1-en-2-yl]-2-prop-2-enylphenol.
| Compound Name | 4-[4-(4-hydroxy-3-prop-2-enylphenyl)-4-methylpent-1-en-2-yl]-2-prop-2-enylphenol |
|---|---|
| PubChem CID | 139713899 |
| Molecular Formula | C24H28O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 4-[4-(4-hydroxy-3-prop-2-enylphenyl)-4-methylpent-1-en-2-yl]-2-prop-2-enylphenol |
| SMILES | C=CCc1cc(C(=C)CC(C)(C)c2ccc(O)c(CC=C)c2)ccc1O |
| InChI | InChI=1S/C24H28O2/c1-6-8-19-14-18(10-12-22(19)25)17(3)16-24(4,5)21-11-13-23(26)20(15-21)9-7-2/h6-7,10-15,25-26H,1-3,8-9,16H2,4-5H3 |
| InChIKey | JHZSLPTYEGMZFL-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|