C21H24O — CID 139341266
2-prop-2-enyl-4-[2-(3-prop-2-enylphenyl)propan-2-yl]phenol (PubChem CID 139341266) has the molecular formula C21H24O and a molecular weight of 292.42 g/mol. Its IUPAC name is 2-prop-2-enyl-4-[2-(3-prop-2-enylphenyl)propan-2-yl]phenol.
| Compound Name | 2-prop-2-enyl-4-[2-(3-prop-2-enylphenyl)propan-2-yl]phenol |
|---|---|
| PubChem CID | 139341266 |
| Molecular Formula | C21H24O |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 2-prop-2-enyl-4-[2-(3-prop-2-enylphenyl)propan-2-yl]phenol |
| SMILES | C=CCc1cccc(C(C)(C)c2ccc(O)c(CC=C)c2)c1 |
| InChI | InChI=1S/C21H24O/c1-5-8-16-10-7-11-18(14-16)21(3,4)19-12-13-20(22)17(15-19)9-6-2/h5-7,10-15,22H,1-2,8-9H2,3-4H3 |
| InChIKey | IZXMUVKJTLRFDL-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|