C27H34O4 — CID 145491393
[4-[2-(4-acetyloxy-3-prop-2-enylphenyl)propan-2-yl]-2-prop-2-enylphenyl] acetate;ethane (PubChem CID 145491393) has the molecular formula C27H34O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is [4-[2-(4-acetyloxy-3-prop-2-enylphenyl)propan-2-yl]-2-prop-2-enylphenyl] acetate;ethane.
| Compound Name | [4-[2-(4-acetyloxy-3-prop-2-enylphenyl)propan-2-yl]-2-prop-2-enylphenyl] acetate;ethane |
|---|---|
| PubChem CID | 145491393 |
| Molecular Formula | C27H34O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | [4-[2-(4-acetyloxy-3-prop-2-enylphenyl)propan-2-yl]-2-prop-2-enylphenyl] acetate;ethane |
| SMILES | C=CCc1cc(C(C)(C)c2ccc(OC(C)=O)c(CC=C)c2)ccc1OC(C)=O.CC |
| InChI | InChI=1S/C25H28O4.C2H6/c1-7-9-19-15-21(11-13-23(19)28-17(3)26)25(5,6)22-12-14-24(29-18(4)27)20(16-22)10-8-2;1-2/h7-8,11-16H,1-2,9-10H2,3-6H3;1-2H3 |
| InChIKey | DSNFDZOHFUHBDU-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|