C31H32O4 — CID 22898031
1-O-methyl 3-O-[4-[2-(4-methyl-3-prop-2-enylphenyl)propan-2-yl]-2-prop-2-enylphenyl] benzene-1,3-dicarboxylate (PubChem CID 22898031) has the molecular formula C31H32O4 and a molecular weight of 468.59 g/mol. Its IUPAC name is 1-O-methyl 3-O-[4-[2-(4-methyl-3-prop-2-enylphenyl)propan-2-yl]-2-prop-2-enylphenyl] benzene-1,3-dicarboxylate.
| Compound Name | 1-O-methyl 3-O-[4-[2-(4-methyl-3-prop-2-enylphenyl)propan-2-yl]-2-prop-2-enylphenyl] benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 22898031 |
| Molecular Formula | C31H32O4 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 1-O-methyl 3-O-[4-[2-(4-methyl-3-prop-2-enylphenyl)propan-2-yl]-2-prop-2-enylphenyl] benzene-1,3-dicarboxylate |
| SMILES | C=CCc1cc(C(C)(C)c2ccc(OC(=O)c3cccc(C(=O)OC)c3)c(CC=C)c2)ccc1C |
| InChI | InChI=1S/C31H32O4/c1-7-10-22-19-26(15-14-21(22)3)31(4,5)27-16-17-28(23(20-27)11-8-2)35-30(33)25-13-9-12-24(18-25)29(32)34-6/h7-9,12-20H,1-2,10-11H2,3-6H3 |
| InChIKey | XSSZHYMGQCWRPA-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|