C26H26O4 — CID 22898061
3-O-[4-[1-(3,4-dimethylphenyl)ethyl]-2-methylphenyl] 1-O-methyl benzene-1,3-dicarboxylate (PubChem CID 22898061) has the molecular formula C26H26O4 and a molecular weight of 402.49 g/mol. Its IUPAC name is 3-O-[4-[1-(3,4-dimethylphenyl)ethyl]-2-methylphenyl] 1-O-methyl benzene-1,3-dicarboxylate.
| Compound Name | 3-O-[4-[1-(3,4-dimethylphenyl)ethyl]-2-methylphenyl] 1-O-methyl benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 22898061 |
| Molecular Formula | C26H26O4 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 3-O-[4-[1-(3,4-dimethylphenyl)ethyl]-2-methylphenyl] 1-O-methyl benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cccc(C(=O)Oc2ccc(C(C)c3ccc(C)c(C)c3)cc2C)c1 |
| InChI | InChI=1S/C26H26O4/c1-16-9-10-20(13-17(16)2)19(4)21-11-12-24(18(3)14-21)30-26(28)23-8-6-7-22(15-23)25(27)29-5/h6-15,19H,1-5H3 |
| InChIKey | GTJPECGXMMEURX-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|