C25H28O4 — CID 59739200
[2-ethyl-4-[2-(3-ethyl-4-prop-2-enoyloxyphenyl)propan-2-yl]phenyl] prop-2-enoate (PubChem CID 59739200) has the molecular formula C25H28O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is [2-ethyl-4-[2-(3-ethyl-4-prop-2-enoyloxyphenyl)propan-2-yl]phenyl] prop-2-enoate.
| Compound Name | [2-ethyl-4-[2-(3-ethyl-4-prop-2-enoyloxyphenyl)propan-2-yl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 59739200 |
| Molecular Formula | C25H28O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | [2-ethyl-4-[2-(3-ethyl-4-prop-2-enoyloxyphenyl)propan-2-yl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(C(C)(C)c2ccc(OC(=O)C=C)c(CC)c2)cc1CC |
| InChI | InChI=1S/C25H28O4/c1-7-17-15-19(11-13-21(17)28-23(26)9-3)25(5,6)20-12-14-22(18(8-2)16-20)29-24(27)10-4/h9-16H,3-4,7-8H2,1-2,5-6H3 |
| InChIKey | BGVVDIXZHOFQIT-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|