C26H28O5 — CID 175484421
(2-ethoxyphenyl) prop-2-enoate;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol (PubChem CID 175484421) has the molecular formula C26H28O5 and a molecular weight of 420.51 g/mol. Its IUPAC name is (2-ethoxyphenyl) prop-2-enoate;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol.
| Compound Name | (2-ethoxyphenyl) prop-2-enoate;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
|---|---|
| PubChem CID | 175484421 |
| Molecular Formula | C26H28O5 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | (2-ethoxyphenyl) prop-2-enoate;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
| SMILES | C=CC(=O)Oc1ccccc1OCC.CC(C)(c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H16O2.C11H12O3/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12;1-3-11(12)14-10-8-6-5-7-9(10)13-4-2/h3-10,16-17H,1-2H3;3,5-8H,1,4H2,2H3 |
| InChIKey | QYKOESLXCUMNGW-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|