C29H40O10 — CID 175878014
bis(prop-2-enoic acid);2,3,5,6-tetraethoxy-4-[2-(4-hydroxyphenyl)propan-2-yl]phenol (PubChem CID 175878014) has the molecular formula C29H40O10 and a molecular weight of 548.63 g/mol. Its IUPAC name is bis(prop-2-enoic acid);2,3,5,6-tetraethoxy-4-[2-(4-hydroxyphenyl)propan-2-yl]phenol.
| Compound Name | bis(prop-2-enoic acid);2,3,5,6-tetraethoxy-4-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
|---|---|
| PubChem CID | 175878014 |
| Molecular Formula | C29H40O10 |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | bis(prop-2-enoic acid);2,3,5,6-tetraethoxy-4-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
| SMILES | C=CC(=O)O.C=CC(=O)O.CCOc1c(O)c(OCC)c(OCC)c(C(C)(C)c2ccc(O)cc2)c1OCC |
| InChI | InChI=1S/C23H32O6.2C3H4O2/c1-7-26-19-17(23(5,6)15-11-13-16(24)14-12-15)20(27-8-2)22(29-10-4)18(25)21(19)28-9-3;2*1-2-3(4)5/h11-14,24-25H,7-10H2,1-6H3;2*2H,1H2,(H,4,5) |
| InChIKey | ZOPNNLMEDQVOOP-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|