C27H32O4 — CID 18179110
(E)-3-[2-ethoxy-6-hydroxy-3,5-bis(2-methylbut-3-en-2-yl)phenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one (PubChem CID 18179110) has the molecular formula C27H32O4 and a molecular weight of 420.55 g/mol. Its IUPAC name is (E)-3-[2-ethoxy-6-hydroxy-3,5-bis(2-methylbut-3-en-2-yl)phenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[2-ethoxy-6-hydroxy-3,5-bis(2-methylbut-3-en-2-yl)phenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 18179110 |
| Molecular Formula | C27H32O4 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | (E)-3-[2-ethoxy-6-hydroxy-3,5-bis(2-methylbut-3-en-2-yl)phenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one |
| SMILES | C=CC(C)(C)c1cc(C(C)(C)C=C)c(OCC)c(/C=C/C(=O)c2ccc(O)cc2)c1O |
| InChI | InChI=1S/C27H32O4/c1-8-26(4,5)21-17-22(27(6,7)9-2)25(31-10-3)20(24(21)30)15-16-23(29)18-11-13-19(28)14-12-18/h8-9,11-17,28,30H,1-2,10H2,3-7H3/b16-15+ |
| InChIKey | NCRLBBHRWIEODP-FOCLMDBBSA-N |
| XLogP | 6.32 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|