C26H35NO3 — CID 54485619
1-(4-aminophenyl)-3-(3,5-ditert-butyl-2-hydroxy-6-propoxyphenyl)prop-2-en-1-one (PubChem CID 54485619) has the molecular formula C26H35NO3 and a molecular weight of 409.57 g/mol. Its IUPAC name is 1-(4-aminophenyl)-3-(3,5-ditert-butyl-2-hydroxy-6-propoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-(4-aminophenyl)-3-(3,5-ditert-butyl-2-hydroxy-6-propoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 54485619 |
| Molecular Formula | C26H35NO3 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | 1-(4-aminophenyl)-3-(3,5-ditert-butyl-2-hydroxy-6-propoxyphenyl)prop-2-en-1-one |
| SMILES | CCCOc1c(C(C)(C)C)cc(C(C)(C)C)c(O)c1C=CC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C26H35NO3/c1-8-15-30-24-19(13-14-22(28)17-9-11-18(27)12-10-17)23(29)20(25(2,3)4)16-21(24)26(5,6)7/h9-14,16,29H,8,15,27H2,1-7H3 |
| InChIKey | XSBQZPTZGKXEAN-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|