C21H24O4 — CID 18178675
(E)-3-(2-ethoxy-3,5-diethyl-6-hydroxyphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one (PubChem CID 18178675) has the molecular formula C21H24O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is (E)-3-(2-ethoxy-3,5-diethyl-6-hydroxyphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(2-ethoxy-3,5-diethyl-6-hydroxyphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 18178675 |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | (E)-3-(2-ethoxy-3,5-diethyl-6-hydroxyphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one |
| SMILES | CCOc1c(CC)cc(CC)c(O)c1/C=C/C(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C21H24O4/c1-4-14-13-15(5-2)21(25-6-3)18(20(14)24)11-12-19(23)16-7-9-17(22)10-8-16/h7-13,22,24H,4-6H2,1-3H3/b12-11+ |
| InChIKey | RGJMHXQYZDYOKK-VAWYXSNFSA-N |
| XLogP | 4.52 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|