C24H26O4 — CID 18178716
(E)-1-(4-hydroxyphenyl)-3-[2-hydroxy-6-propan-2-yloxy-3,5-bis(prop-2-enyl)phenyl]prop-2-en-1-one (PubChem CID 18178716) has the molecular formula C24H26O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is (E)-1-(4-hydroxyphenyl)-3-[2-hydroxy-6-propan-2-yloxy-3,5-bis(prop-2-enyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-hydroxyphenyl)-3-[2-hydroxy-6-propan-2-yloxy-3,5-bis(prop-2-enyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 18178716 |
| Molecular Formula | C24H26O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | (E)-1-(4-hydroxyphenyl)-3-[2-hydroxy-6-propan-2-yloxy-3,5-bis(prop-2-enyl)phenyl]prop-2-en-1-one |
| SMILES | C=CCc1cc(CC=C)c(OC(C)C)c(/C=C/C(=O)c2ccc(O)cc2)c1O |
| InChI | InChI=1S/C24H26O4/c1-5-7-18-15-19(8-6-2)24(28-16(3)4)21(23(18)27)13-14-22(26)17-9-11-20(25)12-10-17/h5-6,9-16,25,27H,1-2,7-8H2,3-4H3/b14-13+ |
| InChIKey | VEBYCPUHTYVPLE-BUHFOSPRSA-N |
| XLogP | 5.24 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|