C27H34O4 — CID 67778620
(E)-3-[3,4-di(propan-2-yloxy)-5-prop-2-enylphenyl]-1-(4-propoxyphenyl)prop-2-en-1-one (PubChem CID 67778620) has the molecular formula C27H34O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is (E)-3-[3,4-di(propan-2-yloxy)-5-prop-2-enylphenyl]-1-(4-propoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[3,4-di(propan-2-yloxy)-5-prop-2-enylphenyl]-1-(4-propoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 67778620 |
| Molecular Formula | C27H34O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | (E)-3-[3,4-di(propan-2-yloxy)-5-prop-2-enylphenyl]-1-(4-propoxyphenyl)prop-2-en-1-one |
| SMILES | C=CCc1cc(/C=C/C(=O)c2ccc(OCCC)cc2)cc(OC(C)C)c1OC(C)C |
| InChI | InChI=1S/C27H34O4/c1-7-9-23-17-21(18-26(30-19(3)4)27(23)31-20(5)6)10-15-25(28)22-11-13-24(14-12-22)29-16-8-2/h7,10-15,17-20H,1,8-9,16H2,2-6H3/b15-10+ |
| InChIKey | YBKZBLNYKATEHU-XNTDXEJSSA-N |
| XLogP | 6.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|