C23H26O4 — CID 54086235
3-(3,5-diethoxy-4-prop-2-enylphenyl)-1-(4-methoxyphenyl)prop-2-en-1-one (PubChem CID 54086235) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is 3-(3,5-diethoxy-4-prop-2-enylphenyl)-1-(4-methoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-(3,5-diethoxy-4-prop-2-enylphenyl)-1-(4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 54086235 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 3-(3,5-diethoxy-4-prop-2-enylphenyl)-1-(4-methoxyphenyl)prop-2-en-1-one |
| SMILES | C=CCc1c(OCC)cc(C=CC(=O)c2ccc(OC)cc2)cc1OCC |
| InChI | InChI=1S/C23H26O4/c1-5-8-20-22(26-6-2)15-17(16-23(20)27-7-3)9-14-21(24)18-10-12-19(25-4)13-11-18/h5,9-16H,1,6-8H2,2-4H3 |
| InChIKey | MQRBSSSIEIPDBH-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|