C25H30O4 — CID 54496377
3-(3,5-diethoxy-4-prop-2-enylphenyl)-1-(4-propoxyphenyl)prop-2-en-1-one (PubChem CID 54496377) has the molecular formula C25H30O4 and a molecular weight of 394.51 g/mol. Its IUPAC name is 3-(3,5-diethoxy-4-prop-2-enylphenyl)-1-(4-propoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-(3,5-diethoxy-4-prop-2-enylphenyl)-1-(4-propoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 54496377 |
| Molecular Formula | C25H30O4 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 3-(3,5-diethoxy-4-prop-2-enylphenyl)-1-(4-propoxyphenyl)prop-2-en-1-one |
| SMILES | C=CCc1c(OCC)cc(C=CC(=O)c2ccc(OCCC)cc2)cc1OCC |
| InChI | InChI=1S/C25H30O4/c1-5-9-22-24(27-7-3)17-19(18-25(22)28-8-4)10-15-23(26)20-11-13-21(14-12-20)29-16-6-2/h5,10-15,17-18H,1,6-9,16H2,2-4H3 |
| InChIKey | XZKBXFVRTRMNQA-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|