C21H21NO3 — CID 27112216
4-[(E)-3-(3-ethoxy-4-propoxyphenyl)prop-2-enoyl]benzonitrile (PubChem CID 27112216) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is 4-[(E)-3-(3-ethoxy-4-propoxyphenyl)prop-2-enoyl]benzonitrile.
| Compound Name | 4-[(E)-3-(3-ethoxy-4-propoxyphenyl)prop-2-enoyl]benzonitrile |
|---|---|
| PubChem CID | 27112216 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 4-[(E)-3-(3-ethoxy-4-propoxyphenyl)prop-2-enoyl]benzonitrile |
| SMILES | CCCOc1ccc(/C=C/C(=O)c2ccc(C#N)cc2)cc1OCC |
| InChI | InChI=1S/C21H21NO3/c1-3-13-25-20-12-8-16(14-21(20)24-4-2)7-11-19(23)18-9-5-17(15-22)6-10-18/h5-12,14H,3-4,13H2,1-2H3/b11-7+ |
| InChIKey | NBGODHSITGJQBI-YRNVUSSQSA-N |
| XLogP | 4.64 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|